C18H11Cl2F3N2O2 — CID 16591104
3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 16591104) has the molecular formula C18H11Cl2F3N2O2 and a molecular weight of 415.20 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 16591104 |
| Molecular Formula | C18H11Cl2F3N2O2 |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccc(Cl)cc2Cl)o1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H11Cl2F3N2O2/c19-9-1-2-10(11(20)7-9)14-8-24-16(27-14)6-5-15(26)25-13-4-3-12(21)17(22)18(13)23/h1-4,7-8H,5-6H2,(H,25,26) |
| InChIKey | QQKFPPYRPQGSAL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|