C20H15ClF3N3O3 — CID 16596029
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 16596029) has the molecular formula C20H15ClF3N3O3 and a molecular weight of 437.81 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 16596029 |
| Molecular Formula | C20H15ClF3N3O3 |
| Molecular Weight | 437.81 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2Cl)o1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H15ClF3N3O3/c21-12-4-2-1-3-11(12)15-9-26-18(30-15)8-7-16(28)25-10-17(29)27-14-6-5-13(22)19(23)20(14)24/h1-6,9H,7-8,10H2,(H,25,28)(H,27,29) |
| InChIKey | ZYSGZCQPUPXBIL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|