C19H12ClF3N2O3 — CID 27895424
5-(2-chlorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide (PubChem CID 27895424) has the molecular formula C19H12ClF3N2O3 and a molecular weight of 408.76 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27895424 |
| Molecular Formula | C19H12ClF3N2O3 |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(-c2ccccc2Cl)o1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H12ClF3N2O3/c20-11-4-2-1-3-10(11)14-7-8-15(28-14)19(27)24-9-16(26)25-13-6-5-12(21)17(22)18(13)23/h1-8H,9H2,(H,24,27)(H,25,26) |
| InChIKey | NMFRYWAOUYPQGT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|