C20H13ClF3NO4 — CID 43026763
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-(2-chlorophenyl)furan-2-carboxylate (PubChem CID 43026763) has the molecular formula C20H13ClF3NO4 and a molecular weight of 423.77 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-(2-chlorophenyl)furan-2-carboxylate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-(2-chlorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 43026763 |
| Molecular Formula | C20H13ClF3NO4 |
| Molecular Weight | 423.77 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-(2-chlorophenyl)furan-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(-c2ccccc2Cl)o1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H13ClF3NO4/c1-10(19(26)25-14-7-6-13(22)17(23)18(14)24)28-20(27)16-9-8-15(29-16)11-4-2-3-5-12(11)21/h2-10H,1H3,(H,25,26) |
| InChIKey | OQZGFIIZUWFDEF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|