C15H9Cl2F3N2O3 — CID 7351860
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 7351860) has the molecular formula C15H9Cl2F3N2O3 and a molecular weight of 393.15 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7351860 |
| Molecular Formula | C15H9Cl2F3N2O3 |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1nc(Cl)ccc1Cl)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H9Cl2F3N2O3/c1-6(25-15(24)13-7(16)2-5-10(17)22-13)14(23)21-9-4-3-8(18)11(19)12(9)20/h2-6H,1H3,(H,21,23)/t6-/m1/s1 |
| InChIKey | JOUBMKDGCNRECJ-ZCFIWIBFSA-N |
| XLogP | 3.99 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|