C19H18F3NO5 — CID 46519596
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-methoxyphenoxy)propanoate (PubChem CID 46519596) has the molecular formula C19H18F3NO5 and a molecular weight of 397.35 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-methoxyphenoxy)propanoate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-methoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 46519596 |
| Molecular Formula | C19H18F3NO5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-methoxyphenoxy)propanoate |
| SMILES | COc1ccc(OC(C)C(=O)OC(C)C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H18F3NO5/c1-10(18(24)23-15-9-8-14(20)16(21)17(15)22)28-19(25)11(2)27-13-6-4-12(26-3)5-7-13/h4-11H,1-3H3,(H,23,24) |
| InChIKey | KMBBUBMNRIYKLH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|