C16H11F3N2O2 — CID 7503342
(2R)-2-(4-cyanophenoxy)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7503342) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is (2R)-2-(4-cyanophenoxy)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-(4-cyanophenoxy)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7503342 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (2R)-2-(4-cyanophenoxy)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H11F3N2O2/c1-9(23-11-4-2-10(8-20)3-5-11)16(22)21-13-7-6-12(17)14(18)15(13)19/h2-7,9H,1H3,(H,21,22)/t9-/m1/s1 |
| InChIKey | IBVLCOYXWQHESC-SECBINFHSA-N |
| XLogP | 3.38 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|