C16H12F2N2O2 — CID 51158907
2-(4-cyanophenoxy)-N-(2,6-difluorophenyl)propanamide (PubChem CID 51158907) has the molecular formula C16H12F2N2O2 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-(2,6-difluorophenyl)propanamide.
| Compound Name | 2-(4-cyanophenoxy)-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 51158907 |
| Molecular Formula | C16H12F2N2O2 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-(2,6-difluorophenyl)propanamide |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C16H12F2N2O2/c1-10(22-12-7-5-11(9-19)6-8-12)16(21)20-15-13(17)3-2-4-14(15)18/h2-8,10H,1H3,(H,20,21) |
| InChIKey | RCQHIXFHOZSMNW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |