C18H14F3NO5 — CID 7296578
1-O-methyl 4-O-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] benzene-1,4-dicarboxylate (PubChem CID 7296578) has the molecular formula C18H14F3NO5 and a molecular weight of 381.31 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] benzene-1,4-dicarboxylate.
| Compound Name | 1-O-methyl 4-O-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 7296578 |
| Molecular Formula | C18H14F3NO5 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-O-methyl 4-O-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)O[C@H](C)C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H14F3NO5/c1-9(16(23)22-13-8-7-12(19)14(20)15(13)21)27-18(25)11-5-3-10(4-6-11)17(24)26-2/h3-9H,1-2H3,(H,22,23)/t9-/m1/s1 |
| InChIKey | CREOIWBGVOZDLJ-SECBINFHSA-N |
| XLogP | 3.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|