C16H12Cl2F2N2O4 — CID 46618220
[1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 46618220) has the molecular formula C16H12Cl2F2N2O4 and a molecular weight of 405.18 g/mol. Its IUPAC name is [1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 46618220 |
| Molecular Formula | C16H12Cl2F2N2O4 |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | [1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | CC(OC(=O)c1nc(Cl)ccc1Cl)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H12Cl2F2N2O4/c1-8(25-15(24)13-9(17)6-7-12(18)22-13)14(23)21-10-4-2-3-5-11(10)26-16(19)20/h2-8,16H,1H3,(H,21,23) |
| InChIKey | UIPPXSXMFVRMEQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|