C15H13ClF2N2O4 — CID 55425996
[1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 4-chloro-1H-pyrrole-2-carboxylate (PubChem CID 55425996) has the molecular formula C15H13ClF2N2O4 and a molecular weight of 358.73 g/mol. Its IUPAC name is [1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 4-chloro-1H-pyrrole-2-carboxylate.
| Compound Name | [1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 4-chloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55425996 |
| Molecular Formula | C15H13ClF2N2O4 |
| Molecular Weight | 358.73 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | [1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 4-chloro-1H-pyrrole-2-carboxylate |
| SMILES | CC(OC(=O)c1cc(Cl)c[nH]1)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H13ClF2N2O4/c1-8(23-14(22)11-6-9(16)7-19-11)13(21)20-10-4-2-3-5-12(10)24-15(17)18/h2-8,15,19H,1H3,(H,20,21) |
| InChIKey | OHUWTQOCNRIMAL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |