C15H14Cl2N2O4 — CID 41291652
[(2S)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-chloro-1H-pyrrole-2-carboxylate (PubChem CID 41291652) has the molecular formula C15H14Cl2N2O4 and a molecular weight of 357.19 g/mol. Its IUPAC name is [(2S)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-chloro-1H-pyrrole-2-carboxylate.
| Compound Name | [(2S)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-chloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 41291652 |
| Molecular Formula | C15H14Cl2N2O4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | [(2S)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-chloro-1H-pyrrole-2-carboxylate |
| SMILES | COc1ccc(Cl)cc1NC(=O)[C@H](C)OC(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C15H14Cl2N2O4/c1-8(23-15(21)12-6-10(17)7-18-12)14(20)19-11-5-9(16)3-4-13(11)22-2/h3-8,18H,1-2H3,(H,19,20)/t8-/m0/s1 |
| InChIKey | AMORHUOJFPNNNK-QMMMGPOBSA-N |
| XLogP | 3.51 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |