C14H9BrF3NO4 — CID 7716872
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-bromofuran-2-carboxylate (PubChem CID 7716872) has the molecular formula C14H9BrF3NO4 and a molecular weight of 392.13 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-bromofuran-2-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 7716872 |
| Molecular Formula | C14H9BrF3NO4 |
| Molecular Weight | 392.13 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-bromofuran-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc(Br)o1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H9BrF3NO4/c1-6(22-14(21)9-4-5-10(15)23-9)13(20)19-8-3-2-7(16)11(17)12(8)18/h2-6H,1H3,(H,19,20)/t6-/m0/s1 |
| InChIKey | FBYCWZVRXVCIPU-LURJTMIESA-N |
| XLogP | 3.64 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|