C13H7BrF3NO4 — CID 2431119
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 5-bromofuran-2-carboxylate (PubChem CID 2431119) has the molecular formula C13H7BrF3NO4 and a molecular weight of 378.10 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 2431119 |
| Molecular Formula | C13H7BrF3NO4 |
| Molecular Weight | 378.10 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 5-bromofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Br)o1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H7BrF3NO4/c14-9-4-3-8(22-9)13(20)21-5-10(19)18-7-2-1-6(15)11(16)12(7)17/h1-4H,5H2,(H,18,19) |
| InChIKey | BJONRVHYJAUSDW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.10 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|