C14H8BrClF3NO4 — CID 2119042
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 2119042) has the molecular formula C14H8BrClF3NO4 and a molecular weight of 426.57 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 2119042 |
| Molecular Formula | C14H8BrClF3NO4 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Br)o1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H8BrClF3NO4/c15-11-4-3-10(24-11)13(22)23-6-12(21)20-9-2-1-7(16)5-8(9)14(17,18)19/h1-5H,6H2,(H,20,21) |
| InChIKey | KIMMYHDOZRCZJL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |