C14H10BrClFNO4 — CID 71820659
[2-[(3-chloro-4-fluorophenyl)methylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 71820659) has the molecular formula C14H10BrClFNO4 and a molecular weight of 390.59 g/mol. Its IUPAC name is [2-[(3-chloro-4-fluorophenyl)methylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[(3-chloro-4-fluorophenyl)methylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 71820659 |
| Molecular Formula | C14H10BrClFNO4 |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | [2-[(3-chloro-4-fluorophenyl)methylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Br)o1)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H10BrClFNO4/c15-12-4-3-11(22-12)14(20)21-7-13(19)18-6-8-1-2-10(17)9(16)5-8/h1-5H,6-7H2,(H,18,19) |
| InChIKey | MHQWMUIGSPQMCL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |