C15H15FN2O6S — CID 55643918
[2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643918) has the molecular formula C15H15FN2O6S and a molecular weight of 370.36 g/mol. Its IUPAC name is [2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643918 |
| Molecular Formula | C15H15FN2O6S |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | Cc1ccc(CNC(=O)COC(=O)c2ccc(S(N)(=O)=O)o2)cc1F |
| InChI | InChI=1S/C15H15FN2O6S/c1-9-2-3-10(6-11(9)16)7-18-13(19)8-23-15(20)12-4-5-14(24-12)25(17,21)22/h2-6H,7-8H2,1H3,(H,18,19)(H2,17,21,22) |
| InChIKey | AAWKLTMKNFVKPT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |