C14H14N2O6S — CID 46426057
[2-(4-methylanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 46426057) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 46426057 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(S(N)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C14H14N2O6S/c1-9-2-4-10(5-3-9)16-12(17)8-21-14(18)11-6-7-13(22-11)23(15,19)20/h2-7H,8H2,1H3,(H,16,17)(H2,15,19,20) |
| InChIKey | YDEIQWWQGAZXFN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |