C15H15N3O7S — CID 55643941
[2-(4-acetamidoanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643941) has the molecular formula C15H15N3O7S and a molecular weight of 381.37 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643941 |
| Molecular Formula | C15H15N3O7S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)c2ccc(S(N)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C15H15N3O7S/c1-9(19)17-10-2-4-11(5-3-10)18-13(20)8-24-15(21)12-6-7-14(25-12)26(16,22)23/h2-7H,8H2,1H3,(H,17,19)(H,18,20)(H2,16,22,23) |
| InChIKey | JHFJYZPOXGLGNF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |