C16H18N2O6S — CID 55644024
[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55644024) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55644024 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | Cc1ccccc1CCNC(=O)COC(=O)c1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C16H18N2O6S/c1-11-4-2-3-5-12(11)8-9-18-14(19)10-23-16(20)13-6-7-15(24-13)25(17,21)22/h2-7H,8-10H2,1H3,(H,18,19)(H2,17,21,22) |
| InChIKey | HCDLHLWJIDBQPM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |