C15H14N2O7S — CID 55643937
[2-(2-acetylanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643937) has the molecular formula C15H14N2O7S and a molecular weight of 366.35 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643937 |
| Molecular Formula | C15H14N2O7S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)c1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C15H14N2O7S/c1-9(18)10-4-2-3-5-11(10)17-13(19)8-23-15(20)12-6-7-14(24-12)25(16,21)22/h2-7H,8H2,1H3,(H,17,19)(H2,16,21,22) |
| InChIKey | NAECXGIPMJSPGM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |