C13H12N2O8S2 — CID 55643701
[2-[(2-methoxycarbonylthiophen-3-yl)amino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643701) has the molecular formula C13H12N2O8S2 and a molecular weight of 388.38 g/mol. Its IUPAC name is [2-[(2-methoxycarbonylthiophen-3-yl)amino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-[(2-methoxycarbonylthiophen-3-yl)amino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643701 |
| Molecular Formula | C13H12N2O8S2 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | [2-[(2-methoxycarbonylthiophen-3-yl)amino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)COC(=O)c1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C13H12N2O8S2/c1-21-13(18)11-7(4-5-24-11)15-9(16)6-22-12(17)8-2-3-10(23-8)25(14,19)20/h2-5H,6H2,1H3,(H,15,16)(H2,14,19,20) |
| InChIKey | MPEUKCGJBTYHMY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |