C14H13NO7S — CID 46426101
(4-methoxycarbonylphenyl)methyl 5-sulfamoylfuran-2-carboxylate (PubChem CID 46426101) has the molecular formula C14H13NO7S and a molecular weight of 339.33 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl 5-sulfamoylfuran-2-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl)methyl 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 46426101 |
| Molecular Formula | C14H13NO7S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl 5-sulfamoylfuran-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2ccc(S(N)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C14H13NO7S/c1-20-13(16)10-4-2-9(3-5-10)8-21-14(17)11-6-7-12(22-11)23(15,18)19/h2-7H,8H2,1H3,(H2,15,18,19) |
| InChIKey | FASHSFUYCVWPLE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |