C15H14N2O8S — CID 55643755
[2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643755) has the molecular formula C15H14N2O8S and a molecular weight of 382.35 g/mol. Its IUPAC name is [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643755 |
| Molecular Formula | C15H14N2O8S |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | COc1ccc(C(=O)NC(=O)COC(=O)c2ccc(S(N)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C15H14N2O8S/c1-23-10-4-2-9(3-5-10)14(19)17-12(18)8-24-15(20)11-6-7-13(25-11)26(16,21)22/h2-7H,8H2,1H3,(H2,16,21,22)(H,17,18,19) |
| InChIKey | WVSKMHUPVLOVTN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |