C14H13N3O9S — CID 55644003
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55644003) has the molecular formula C14H13N3O9S and a molecular weight of 399.34 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55644003 |
| Molecular Formula | C14H13N3O9S |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C14H13N3O9S/c1-24-11-6-8(17(20)21)2-3-9(11)16-12(18)7-25-14(19)10-4-5-13(26-10)27(15,22)23/h2-6H,7H2,1H3,(H,16,18)(H2,15,22,23) |
| InChIKey | DIDNGMXUQUHXDE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 181.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|