C21H14F3NO6 — CID 43026963
[2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 5-(4-fluorophenyl)furan-2-carboxylate (PubChem CID 43026963) has the molecular formula C21H14F3NO6 and a molecular weight of 433.34 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 5-(4-fluorophenyl)furan-2-carboxylate.
| Compound Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 5-(4-fluorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 43026963 |
| Molecular Formula | C21H14F3NO6 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 5-(4-fluorophenyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccc(F)cc2)o1)NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H14F3NO6/c22-14-5-1-12(2-6-14)16-9-10-17(31-16)20(28)29-11-18(26)25-19(27)13-3-7-15(8-4-13)30-21(23)24/h1-10,21H,11H2,(H,25,26,27) |
| InChIKey | RYHNODSEHKJXLE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |