C17H17FN2O5S — CID 25434009
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-methyl-3-sulfamoylbenzoate (PubChem CID 25434009) has the molecular formula C17H17FN2O5S and a molecular weight of 380.40 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-methyl-3-sulfamoylbenzoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-methyl-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 25434009 |
| Molecular Formula | C17H17FN2O5S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-methyl-3-sulfamoylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NCc2ccc(F)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H17FN2O5S/c1-11-2-5-13(8-15(11)26(19,23)24)17(22)25-10-16(21)20-9-12-3-6-14(18)7-4-12/h2-8H,9-10H2,1H3,(H,20,21)(H2,19,23,24) |
| InChIKey | GYQSHXGBJLFLMH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |