C18H18FNO5 — CID 2516189
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3,5-dimethoxybenzoate (PubChem CID 2516189) has the molecular formula C18H18FNO5 and a molecular weight of 347.34 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2516189 |
| Molecular Formula | C18H18FNO5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCC(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H18FNO5/c1-23-15-7-13(8-16(9-15)24-2)18(22)25-11-17(21)20-10-12-3-5-14(19)6-4-12/h3-9H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | QZOUPOIKMVLECJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |