C18H17FN2O5 — CID 8678473
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate (PubChem CID 8678473) has the molecular formula C18H17FN2O5 and a molecular weight of 360.34 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 8678473 |
| Molecular Formula | C18H17FN2O5 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate |
| SMILES | NC(=O)COc1ccc(C(=O)OCC(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H17FN2O5/c19-14-5-1-12(2-6-14)9-21-17(23)11-26-18(24)13-3-7-15(8-4-13)25-10-16(20)22/h1-8H,9-11H2,(H2,20,22)(H,21,23) |
| InChIKey | XDWUOUWQDQTBTN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |