C18H18N2O5 — CID 7931566
methyl 4-[[[2-(4-carbamoylphenoxy)acetyl]amino]methyl]benzoate (PubChem CID 7931566) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl 4-[[[2-(4-carbamoylphenoxy)acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-(4-carbamoylphenoxy)acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 7931566 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 4-[[[2-(4-carbamoylphenoxy)acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)COc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C18H18N2O5/c1-24-18(23)14-4-2-12(3-5-14)10-20-16(21)11-25-15-8-6-13(7-9-15)17(19)22/h2-9H,10-11H2,1H3,(H2,19,22)(H,20,21) |
| InChIKey | CMSVYKTZPSVMPI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |