C15H14BrNO5 — CID 8014074
[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 8014074) has the molecular formula C15H14BrNO5 and a molecular weight of 368.18 g/mol. Its IUPAC name is [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 8014074 |
| Molecular Formula | C15H14BrNO5 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | COc1cccc(CNC(=O)COC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C15H14BrNO5/c1-20-11-4-2-3-10(7-11)8-17-14(18)9-21-15(19)12-5-6-13(16)22-12/h2-7H,8-9H2,1H3,(H,17,18) |
| InChIKey | SAUJMVHTTJFERJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |