C18H18BrNO5 — CID 8875944
[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-bromo-4-methoxybenzoate (PubChem CID 8875944) has the molecular formula C18H18BrNO5 and a molecular weight of 408.25 g/mol. Its IUPAC name is [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-bromo-4-methoxybenzoate.
| Compound Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-bromo-4-methoxybenzoate |
|---|---|
| PubChem CID | 8875944 |
| Molecular Formula | C18H18BrNO5 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-bromo-4-methoxybenzoate |
| SMILES | COc1cccc(CNC(=O)COC(=O)c2ccc(OC)c(Br)c2)c1 |
| InChI | InChI=1S/C18H18BrNO5/c1-23-14-5-3-4-12(8-14)10-20-17(21)11-25-18(22)13-6-7-16(24-2)15(19)9-13/h3-9H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | FXXJUNONRASBFW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |