C19H17F3N2O4 — CID 7364824
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 4-ethylbenzoate (PubChem CID 7364824) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 4-ethylbenzoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 7364824 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H17F3N2O4/c1-2-11-3-5-12(6-4-11)19(27)28-10-16(26)23-9-15(25)24-14-8-7-13(20)17(21)18(14)22/h3-8H,2,9-10H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | VXWBRJXWYHUGNE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|