C18H15F3N2O5 — CID 7416448
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 2-hydroxy-3-methylbenzoate (PubChem CID 7416448) has the molecular formula C18H15F3N2O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 2-hydroxy-3-methylbenzoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 7416448 |
| Molecular Formula | C18H15F3N2O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)c1O |
| InChI | InChI=1S/C18H15F3N2O5/c1-9-3-2-4-10(17(9)26)18(27)28-8-14(25)22-7-13(24)23-12-6-5-11(19)15(20)16(12)21/h2-6,26H,7-8H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | LWXKAVYABKOKIG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|