C19H19NO6 — CID 7416041
[2-(5-methoxycarbonyl-2-methylanilino)-2-oxoethyl] 2-hydroxy-3-methylbenzoate (PubChem CID 7416041) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is [2-(5-methoxycarbonyl-2-methylanilino)-2-oxoethyl] 2-hydroxy-3-methylbenzoate.
| Compound Name | [2-(5-methoxycarbonyl-2-methylanilino)-2-oxoethyl] 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 7416041 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [2-(5-methoxycarbonyl-2-methylanilino)-2-oxoethyl] 2-hydroxy-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)COC(=O)c2cccc(C)c2O)c1 |
| InChI | InChI=1S/C19H19NO6/c1-11-7-8-13(18(23)25-3)9-15(11)20-16(21)10-26-19(24)14-6-4-5-12(2)17(14)22/h4-9,22H,10H2,1-3H3,(H,20,21) |
| InChIKey | MEHWJMRWMCMWCN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |