C18H17NO5 — CID 2578372
[2-(4-acetylanilino)-2-oxoethyl] 2-hydroxy-3-methylbenzoate (PubChem CID 2578372) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 2-hydroxy-3-methylbenzoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 2578372 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 2-hydroxy-3-methylbenzoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)c2cccc(C)c2O)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-11-4-3-5-15(17(11)22)18(23)24-10-16(21)19-14-8-6-13(7-9-14)12(2)20/h3-9,22H,10H2,1-2H3,(H,19,21) |
| InChIKey | JSMQZZRHLJUKKB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |