C17H15NO5 — CID 7416144
(2-benzamido-2-oxoethyl) 2-hydroxy-3-methylbenzoate (PubChem CID 7416144) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-hydroxy-3-methylbenzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 7416144 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)NC(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C17H15NO5/c1-11-6-5-9-13(15(11)20)17(22)23-10-14(19)18-16(21)12-7-3-2-4-8-12/h2-9,20H,10H2,1H3,(H,18,19,21) |
| InChIKey | WPPQFIYEYMZZHH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |