About (2-benzamido-2-oxoethyl) 2-chlorobenzoate
(2-benzamido-2-oxoethyl) 2-chlorobenzoate (PubChem CID 2624247) has the molecular formula C16H12ClNO4
and a molecular weight of 317.73 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-chlorobenzoate.
Molecular Properties
| Compound Name | (2-benzamido-2-oxoethyl) 2-chlorobenzoate |
| PubChem CID | 2624247 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H12ClNO4/c17-13-9-5-4-8-12(13)16(21)22-10-14(19)18-15(20)11-6-2-1-3-7-11/h1-9H,10H2,(H,18,19,20) |
| InChIKey | WDYXFASENLYQMC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-benzamido-2-oxoethyl) 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzamido-2-oxoethyl) 2-chlorobenzoate?
The IUPAC name of (2-benzamido-2-oxoethyl) 2-chlorobenzoate (CID 2624247) is (2-benzamido-2-oxoethyl) 2-chlorobenzoate.
What is the SMILES notation for (2-benzamido-2-oxoethyl) 2-chlorobenzoate?
The canonical SMILES for (2-benzamido-2-oxoethyl) 2-chlorobenzoate is O=C(COC(=O)c1ccccc1Cl)NC(=O)c1ccccc1.
What is the InChIKey of (2-benzamido-2-oxoethyl) 2-chlorobenzoate?
The InChIKey is WDYXFASENLYQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO4/c17-13-9-5-4-8-12(13)16(21)22-10-14(19)18-15(20)11-6-2-1-3-7-11/h1-9H,10H2,(H,18,19,20).
What are the key properties of (2-benzamido-2-oxoethyl) 2-chlorobenzoate?
(2-benzamido-2-oxoethyl) 2-chlorobenzoate has a molecular weight of 317.73 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamido-2-oxoethyl) 2-chlorobenzoate is sourced from PubChem (CID 2624247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).