C23H17ClN2O5 — CID 30221163
(2-benzamido-2-oxoethyl) 2-[(4-chlorobenzoyl)amino]benzoate (PubChem CID 30221163) has the molecular formula C23H17ClN2O5 and a molecular weight of 436.85 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-[(4-chlorobenzoyl)amino]benzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-[(4-chlorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 30221163 |
| Molecular Formula | C23H17ClN2O5 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-[(4-chlorobenzoyl)amino]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NC(=O)c1ccc(Cl)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H17ClN2O5/c24-17-12-10-16(11-13-17)21(28)25-19-9-5-4-8-18(19)23(30)31-14-20(27)26-22(29)15-6-2-1-3-7-15/h1-13H,14H2,(H,25,28)(H,26,27,29) |
| InChIKey | FKQOKMGDQPURRE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |