About (4-carbamoylphenyl)methyl 2-benzamidobenzoate
(4-carbamoylphenyl)methyl 2-benzamidobenzoate (PubChem CID 17410103) has the molecular formula C22H18N2O4
and a molecular weight of 374.40 g/mol. Its IUPAC name is (4-carbamoylphenyl)methyl 2-benzamidobenzoate.
Molecular Properties
| Compound Name | (4-carbamoylphenyl)methyl 2-benzamidobenzoate |
| PubChem CID | 17410103 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (4-carbamoylphenyl)methyl 2-benzamidobenzoate |
| SMILES | NC(=O)c1ccc(COC(=O)c2ccccc2NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2O4/c23-20(25)16-12-10-15(11-13-16)14-28-22(27)18-8-4-5-9-19(18)24-21(26)17-6-2-1-3-7-17/h1-13H,14H2,(H2,23,25)(H,24,26) |
| InChIKey | CVIWBRNYRAOHOY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-carbamoylphenyl)methyl 2-benzamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamoylphenyl)methyl 2-benzamidobenzoate?
The IUPAC name of (4-carbamoylphenyl)methyl 2-benzamidobenzoate (CID 17410103) is (4-carbamoylphenyl)methyl 2-benzamidobenzoate.
What is the SMILES notation for (4-carbamoylphenyl)methyl 2-benzamidobenzoate?
The canonical SMILES for (4-carbamoylphenyl)methyl 2-benzamidobenzoate is NC(=O)c1ccc(COC(=O)c2ccccc2NC(=O)c2ccccc2)cc1.
What is the InChIKey of (4-carbamoylphenyl)methyl 2-benzamidobenzoate?
The InChIKey is CVIWBRNYRAOHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O4/c23-20(25)16-12-10-15(11-13-16)14-28-22(27)18-8-4-5-9-19(18)24-21(26)17-6-2-1-3-7-17/h1-13H,14H2,(H2,23,25)(H,24,26).
What are the key properties of (4-carbamoylphenyl)methyl 2-benzamidobenzoate?
(4-carbamoylphenyl)methyl 2-benzamidobenzoate has a molecular weight of 374.40 g/mol, XLogP of 3.39, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamoylphenyl)methyl 2-benzamidobenzoate is sourced from PubChem (CID 17410103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).