About 2-benzamidobenzamide
2-benzamidobenzamide (PubChem CID 702115) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-benzamidobenzamide.
Molecular Properties
| Compound Name | 2-benzamidobenzamide |
| PubChem CID | 702115 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-benzamidobenzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O2/c15-13(17)11-8-4-5-9-12(11)16-14(18)10-6-2-1-3-7-10/h1-9H,(H2,15,17)(H,16,18) |
| InChIKey | SISHWAKQUGSWBG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzamidobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamidobenzamide?
The IUPAC name of 2-benzamidobenzamide (CID 702115) is 2-benzamidobenzamide.
What is the SMILES notation for 2-benzamidobenzamide?
The canonical SMILES for 2-benzamidobenzamide is NC(=O)c1ccccc1NC(=O)c1ccccc1.
What is the InChIKey of 2-benzamidobenzamide?
The InChIKey is SISHWAKQUGSWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c15-13(17)11-8-4-5-9-12(11)16-14(18)10-6-2-1-3-7-10/h1-9H,(H2,15,17)(H,16,18).
What are the key properties of 2-benzamidobenzamide?
2-benzamidobenzamide has a molecular weight of 240.26 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamidobenzamide is sourced from PubChem (CID 702115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).