About zinc bis(2-benzamidobenzoate)
zinc bis(2-benzamidobenzoate) (PubChem CID 67586546) has the molecular formula C28H20N2O6Zn
and a molecular weight of 545.87 g/mol. Its IUPAC name is zinc bis(2-benzamidobenzoate).
Molecular Properties
| Compound Name | zinc bis(2-benzamidobenzoate) |
| PubChem CID | 67586546 |
| Molecular Formula | C28H20N2O6Zn |
| Molecular Weight | 545.87 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | zinc bis(2-benzamidobenzoate) |
| SMILES | O=C(Nc1ccccc1C(=O)[O-])c1ccccc1.O=C(Nc1ccccc1C(=O)[O-])c1ccccc1.[Zn+2] |
| InChI | InChI=1S/2C14H11NO3.Zn/c2*16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18;/h2*1-9H,(H,15,16)(H,17,18);/q;;+2/p-2 |
| InChIKey | ALBRVBJABKOZCI-UHFFFAOYSA-L |
| XLogP | 2.60 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 545.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2-benzamidobenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2-benzamidobenzoate)?
The IUPAC name of zinc bis(2-benzamidobenzoate) (CID 67586546) is zinc bis(2-benzamidobenzoate).
What is the SMILES notation for zinc bis(2-benzamidobenzoate)?
The canonical SMILES for zinc bis(2-benzamidobenzoate) is O=C(Nc1ccccc1C(=O)[O-])c1ccccc1.O=C(Nc1ccccc1C(=O)[O-])c1ccccc1.[Zn+2].
What is the InChIKey of zinc bis(2-benzamidobenzoate)?
The InChIKey is ALBRVBJABKOZCI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H11NO3.Zn/c2*16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18;/h2*1-9H,(H,15,16)(H,17,18);/q;;+2/p-2.
What are the key properties of zinc bis(2-benzamidobenzoate)?
zinc bis(2-benzamidobenzoate) has a molecular weight of 545.87 g/mol, XLogP of 2.60, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2-benzamidobenzoate) is sourced from PubChem (CID 67586546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).