C20H13ClNO5S- — CID 2252777
2-[[4-(4-chlorophenyl)sulfonylbenzoyl]amino]benzoate (PubChem CID 2252777) has the molecular formula C20H13ClNO5S- and a molecular weight of 414.85 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)sulfonylbenzoyl]amino]benzoate.
| Compound Name | 2-[[4-(4-chlorophenyl)sulfonylbenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 2252777 |
| Molecular Formula | C20H13ClNO5S- |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)sulfonylbenzoyl]amino]benzoate |
| SMILES | O=C(Nc1ccccc1C(=O)[O-])c1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H14ClNO5S/c21-14-7-11-16(12-8-14)28(26,27)15-9-5-13(6-10-15)19(23)22-18-4-2-1-3-17(18)20(24)25/h1-12H,(H,22,23)(H,24,25)/p-1 |
| InChIKey | XSYVLYCQZMFYRE-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |