C16H11NO7S-2 — CID 7154600
2-[[3-(carboxylatomethylsulfonyl)benzoyl]amino]benzoate (PubChem CID 7154600) has the molecular formula C16H11NO7S-2 and a molecular weight of 361.33 g/mol. Its IUPAC name is 2-[[3-(carboxylatomethylsulfonyl)benzoyl]amino]benzoate.
| Compound Name | 2-[[3-(carboxylatomethylsulfonyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 7154600 |
| Molecular Formula | C16H11NO7S-2 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-[[3-(carboxylatomethylsulfonyl)benzoyl]amino]benzoate |
| SMILES | O=C([O-])CS(=O)(=O)c1cccc(C(=O)Nc2ccccc2C(=O)[O-])c1 |
| InChI | InChI=1S/C16H13NO7S/c18-14(19)9-25(23,24)11-5-3-4-10(8-11)15(20)17-13-7-2-1-6-12(13)16(21)22/h1-8H,9H2,(H,17,20)(H,18,19)(H,21,22)/p-2 |
| InChIKey | GZXALMKNUSPIHP-UHFFFAOYSA-L |
| XLogP | -1.17 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |