C14H8N3O3S- — CID 6919302
2-(2,1,3-benzothiadiazole-5-carbonylamino)benzoate (PubChem CID 6919302) has the molecular formula C14H8N3O3S- and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazole-5-carbonylamino)benzoate.
| Compound Name | 2-(2,1,3-benzothiadiazole-5-carbonylamino)benzoate |
|---|---|
| PubChem CID | 6919302 |
| Molecular Formula | C14H8N3O3S- |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(2,1,3-benzothiadiazole-5-carbonylamino)benzoate |
| SMILES | O=C(Nc1ccccc1C(=O)[O-])c1ccc2nsnc2c1 |
| InChI | InChI=1S/C14H9N3O3S/c18-13(8-5-6-11-12(7-8)17-21-16-11)15-10-4-2-1-3-9(10)14(19)20/h1-7H,(H,15,18)(H,19,20)/p-1 |
| InChIKey | LKDQINYZBWZFQF-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |