C17H16N4OS — CID 17313981
N-(2-pyrrolidin-1-ylphenyl)-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17313981) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylphenyl)-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-(2-pyrrolidin-1-ylphenyl)-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17313981 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-(2-pyrrolidin-1-ylphenyl)-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCC1)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C17H16N4OS/c22-17(12-7-8-13-15(11-12)20-23-19-13)18-14-5-1-2-6-16(14)21-9-3-4-10-21/h1-2,5-8,11H,3-4,9-10H2,(H,18,22) |
| InChIKey | OTWWCZARVCJUAG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |