C16H12N4O3S2 — CID 17099248
methyl 2-(2,1,3-benzothiadiazole-5-carbonylcarbamothioylamino)benzoate (PubChem CID 17099248) has the molecular formula C16H12N4O3S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is methyl 2-(2,1,3-benzothiadiazole-5-carbonylcarbamothioylamino)benzoate.
| Compound Name | methyl 2-(2,1,3-benzothiadiazole-5-carbonylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 17099248 |
| Molecular Formula | C16H12N4O3S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | methyl 2-(2,1,3-benzothiadiazole-5-carbonylcarbamothioylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)NC(=O)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C16H12N4O3S2/c1-23-15(22)10-4-2-3-5-11(10)17-16(24)18-14(21)9-6-7-12-13(8-9)20-25-19-12/h2-8H,1H3,(H2,17,18,21,24) |
| InChIKey | WPGYPOHHZMDPAS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|