C15H11N3O3S — CID 26817794
methyl 2-(1,2,3-benzothiadiazole-5-carbonylamino)benzoate (PubChem CID 26817794) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is methyl 2-(1,2,3-benzothiadiazole-5-carbonylamino)benzoate.
| Compound Name | methyl 2-(1,2,3-benzothiadiazole-5-carbonylamino)benzoate |
|---|---|
| PubChem CID | 26817794 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | methyl 2-(1,2,3-benzothiadiazole-5-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc2snnc2c1 |
| InChI | InChI=1S/C15H11N3O3S/c1-21-15(20)10-4-2-3-5-11(10)16-14(19)9-6-7-13-12(8-9)17-18-22-13/h2-8H,1H3,(H,16,19) |
| InChIKey | PCNILRDLOFEEFI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |