C10H11N3OS — CID 1092686
N-propan-2-yl-1,2,3-benzothiadiazole-5-carboxamide (PubChem CID 1092686) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is N-propan-2-yl-1,2,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-propan-2-yl-1,2,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 1092686 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-propan-2-yl-1,2,3-benzothiadiazole-5-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc2snnc2c1 |
| InChI | InChI=1S/C10H11N3OS/c1-6(2)11-10(14)7-3-4-9-8(5-7)12-13-15-9/h3-6H,1-2H3,(H,11,14) |
| InChIKey | QOMDDCITHYXZNE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |