C10H10N2OS — CID 117294869
3-(1,2,3-benzothiadiazol-5-yl)butanal (PubChem CID 117294869) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-(1,2,3-benzothiadiazol-5-yl)butanal.
| Compound Name | 3-(1,2,3-benzothiadiazol-5-yl)butanal |
|---|---|
| PubChem CID | 117294869 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3-(1,2,3-benzothiadiazol-5-yl)butanal |
| SMILES | CC(CC=O)c1ccc2snnc2c1 |
| InChI | InChI=1S/C10H10N2OS/c1-7(4-5-13)8-2-3-10-9(6-8)11-12-14-10/h2-3,5-7H,4H2,1H3 |
| InChIKey | YDGBAWAYVQFDCH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|